C19H36O2Si — CID 22150782
(E)-4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-ol (PubChem CID 22150782) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is (E)-4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-ol.
| Compound Name | (E)-4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 22150782 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (E)-4-[4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-ol |
| SMILES | CC1=C(/C=C/C(C)O)C(C)(C)CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H36O2Si/c1-14-12-16(21-22(8,9)18(3,4)5)13-19(6,7)17(14)11-10-15(2)20/h10-11,15-16,20H,12-13H2,1-9H3/b11-10+ |
| InChIKey | LCEVJSQXUPPTSI-ZHACJKMWSA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|