C20H36O2Si — CID 22150785
(E)-1-[4-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethylcyclopenten-1-yl]hex-1-en-3-one (PubChem CID 22150785) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (E)-1-[4-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethylcyclopenten-1-yl]hex-1-en-3-one.
| Compound Name | (E)-1-[4-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethylcyclopenten-1-yl]hex-1-en-3-one |
|---|---|
| PubChem CID | 22150785 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (E)-1-[4-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethylcyclopenten-1-yl]hex-1-en-3-one |
| SMILES | CCCC(=O)/C=C/C1=C(C)CC(O[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-10-11-16(21)12-13-17-15(2)14-18(20(17,6)7)22-23(8,9)19(3,4)5/h12-13,18H,10-11,14H2,1-9H3/b13-12+ |
| InChIKey | DPFFPPUMOBYXGA-OUKQBFOZSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|