About 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride
2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride (PubChem CID 22151120) has the molecular formula C10H9Cl2NO4S
and a molecular weight of 310.16 g/mol. Its IUPAC name is 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride |
| PubChem CID | 22151120 |
| Molecular Formula | C10H9Cl2NO4S |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride |
| SMILES | O=C1OCCN1Cc1cccc(Cl)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H9Cl2NO4S/c11-8-3-1-2-7(9(8)18(12,15)16)6-13-4-5-17-10(13)14/h1-3H,4-6H2 |
| InChIKey | IIUVRGQVXUWPED-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride?
The IUPAC name of 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride (CID 22151120) is 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride.
What is the SMILES notation for 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride?
The canonical SMILES for 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride is O=C1OCCN1Cc1cccc(Cl)c1S(=O)(=O)Cl.
What is the InChIKey of 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride?
The InChIKey is IIUVRGQVXUWPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO4S/c11-8-3-1-2-7(9(8)18(12,15)16)6-13-4-5-17-10(13)14/h1-3H,4-6H2.
What are the key properties of 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride?
2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride has a molecular weight of 310.16 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[(2-oxo-1,3-oxazolidin-3-yl)methyl]benzenesulfonyl chloride is sourced from PubChem (CID 22151120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).