About 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene
3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene (PubChem CID 22151661) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene.
Molecular Properties
| Compound Name | 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene |
| PubChem CID | 22151661 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene |
| SMILES | C=CC(OC(C=C)C(C)(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C16H30O/c1-9-13(15(5,6)11-3)17-14(10-2)16(7,8)12-4/h9-10,13-14H,1-2,11-12H2,3-8H3 |
| InChIKey | IUOJUCDJJFLPFN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene?
The IUPAC name of 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene (CID 22151661) is 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene.
What is the SMILES notation for 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene?
The canonical SMILES for 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene is C=CC(OC(C=C)C(C)(C)CC)C(C)(C)CC.
What is the InChIKey of 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene?
The InChIKey is IUOJUCDJJFLPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O/c1-9-13(15(5,6)11-3)17-14(10-2)16(7,8)12-4/h9-10,13-14H,1-2,11-12H2,3-8H3.
What are the key properties of 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene?
3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene has a molecular weight of 238.41 g/mol, XLogP of 4.98, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-dimethylhex-1-en-3-yloxy)-4,4-dimethylhex-1-ene is sourced from PubChem (CID 22151661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).