About 1-methylpyrrolidin-2-one;propan-1-ol
1-methylpyrrolidin-2-one;propan-1-ol (PubChem CID 22151758) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;propan-1-ol.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;propan-1-ol |
| PubChem CID | 22151758 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 1-methylpyrrolidin-2-one;propan-1-ol |
| SMILES | CCCO.CN1CCCC1=O |
| InChI | InChI=1S/C5H9NO.C3H8O/c1-6-4-2-3-5(6)7;1-2-3-4/h2-4H2,1H3;4H,2-3H2,1H3 |
| InChIKey | AHORDIWXQNKXEY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpyrrolidin-2-one;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;propan-1-ol?
The IUPAC name of 1-methylpyrrolidin-2-one;propan-1-ol (CID 22151758) is 1-methylpyrrolidin-2-one;propan-1-ol.
What is the SMILES notation for 1-methylpyrrolidin-2-one;propan-1-ol?
The canonical SMILES for 1-methylpyrrolidin-2-one;propan-1-ol is CCCO.CN1CCCC1=O.
What is the InChIKey of 1-methylpyrrolidin-2-one;propan-1-ol?
The InChIKey is AHORDIWXQNKXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C3H8O/c1-6-4-2-3-5(6)7;1-2-3-4/h2-4H2,1H3;4H,2-3H2,1H3.
What are the key properties of 1-methylpyrrolidin-2-one;propan-1-ol?
1-methylpyrrolidin-2-one;propan-1-ol has a molecular weight of 159.23 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;propan-1-ol is sourced from PubChem (CID 22151758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).