About 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine
2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine (PubChem CID 22151764) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine.
Molecular Properties
| Compound Name | 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine |
| PubChem CID | 22151764 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine |
| SMILES | C=C/C=C/c1cc(C)cc(C)n1 |
| InChI | InChI=1S/C11H13N/c1-4-5-6-11-8-9(2)7-10(3)12-11/h4-8H,1H2,2-3H3/b6-5+ |
| InChIKey | YYOATBWUZDSQGV-AATRIKPKSA-N |
| XLogP | 2.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine?
The IUPAC name of 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine (CID 22151764) is 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine.
What is the SMILES notation for 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine?
The canonical SMILES for 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine is C=C/C=C/c1cc(C)cc(C)n1.
What is the InChIKey of 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine?
The InChIKey is YYOATBWUZDSQGV-AATRIKPKSA-N. The full InChI is InChI=1S/C11H13N/c1-4-5-6-11-8-9(2)7-10(3)12-11/h4-8H,1H2,2-3H3/b6-5+.
What are the key properties of 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine?
2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine has a molecular weight of 159.23 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-buta-1,3-dienyl]-4,6-dimethylpyridine is sourced from PubChem (CID 22151764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).