About 5,6-dimethylpyrazine-2,3-dicarbaldehyde
5,6-dimethylpyrazine-2,3-dicarbaldehyde (PubChem CID 22151767) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5,6-dimethylpyrazine-2,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 5,6-dimethylpyrazine-2,3-dicarbaldehyde |
| PubChem CID | 22151767 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5,6-dimethylpyrazine-2,3-dicarbaldehyde |
| SMILES | Cc1nc(C=O)c(C=O)nc1C |
| InChI | InChI=1S/C8H8N2O2/c1-5-6(2)10-8(4-12)7(3-11)9-5/h3-4H,1-2H3 |
| InChIKey | GBLXTBFDHMGZCO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethylpyrazine-2,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethylpyrazine-2,3-dicarbaldehyde?
The IUPAC name of 5,6-dimethylpyrazine-2,3-dicarbaldehyde (CID 22151767) is 5,6-dimethylpyrazine-2,3-dicarbaldehyde.
What is the SMILES notation for 5,6-dimethylpyrazine-2,3-dicarbaldehyde?
The canonical SMILES for 5,6-dimethylpyrazine-2,3-dicarbaldehyde is Cc1nc(C=O)c(C=O)nc1C.
What is the InChIKey of 5,6-dimethylpyrazine-2,3-dicarbaldehyde?
The InChIKey is GBLXTBFDHMGZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c1-5-6(2)10-8(4-12)7(3-11)9-5/h3-4H,1-2H3.
What are the key properties of 5,6-dimethylpyrazine-2,3-dicarbaldehyde?
5,6-dimethylpyrazine-2,3-dicarbaldehyde has a molecular weight of 164.16 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethylpyrazine-2,3-dicarbaldehyde is sourced from PubChem (CID 22151767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).