About 1H-pyrazine-2,3,4,5-tetracarbaldehyde
1H-pyrazine-2,3,4,5-tetracarbaldehyde (PubChem CID 22151769) has the molecular formula C8H6N2O4
and a molecular weight of 194.15 g/mol. Its IUPAC name is 1H-pyrazine-2,3,4,5-tetracarbaldehyde.
Molecular Properties
| Compound Name | 1H-pyrazine-2,3,4,5-tetracarbaldehyde |
| PubChem CID | 22151769 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 1H-pyrazine-2,3,4,5-tetracarbaldehyde |
| SMILES | O=CC1=CNC(C=O)=C(C=O)N1C=O |
| InChI | InChI=1S/C8H6N2O4/c11-2-6-1-9-7(3-12)8(4-13)10(6)5-14/h1-5,9H |
| InChIKey | CWSQLABDCHGISJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazine-2,3,4,5-tetracarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazine-2,3,4,5-tetracarbaldehyde?
The IUPAC name of 1H-pyrazine-2,3,4,5-tetracarbaldehyde (CID 22151769) is 1H-pyrazine-2,3,4,5-tetracarbaldehyde.
What is the SMILES notation for 1H-pyrazine-2,3,4,5-tetracarbaldehyde?
The canonical SMILES for 1H-pyrazine-2,3,4,5-tetracarbaldehyde is O=CC1=CNC(C=O)=C(C=O)N1C=O.
What is the InChIKey of 1H-pyrazine-2,3,4,5-tetracarbaldehyde?
The InChIKey is CWSQLABDCHGISJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O4/c11-2-6-1-9-7(3-12)8(4-13)10(6)5-14/h1-5,9H.
What are the key properties of 1H-pyrazine-2,3,4,5-tetracarbaldehyde?
1H-pyrazine-2,3,4,5-tetracarbaldehyde has a molecular weight of 194.15 g/mol, XLogP of -1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazine-2,3,4,5-tetracarbaldehyde is sourced from PubChem (CID 22151769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).