About 5-bromonaphthalene-1,6-dicarbaldehyde
5-bromonaphthalene-1,6-dicarbaldehyde (PubChem CID 22151791) has the molecular formula C12H7BrO2
and a molecular weight of 263.09 g/mol. Its IUPAC name is 5-bromonaphthalene-1,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 5-bromonaphthalene-1,6-dicarbaldehyde |
| PubChem CID | 22151791 |
| Molecular Formula | C12H7BrO2 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 5-bromonaphthalene-1,6-dicarbaldehyde |
| SMILES | O=Cc1ccc2c(C=O)cccc2c1Br |
| InChI | InChI=1S/C12H7BrO2/c13-12-9(7-15)4-5-10-8(6-14)2-1-3-11(10)12/h1-7H |
| InChIKey | GRTWYYHRIROQRR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromonaphthalene-1,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromonaphthalene-1,6-dicarbaldehyde?
The IUPAC name of 5-bromonaphthalene-1,6-dicarbaldehyde (CID 22151791) is 5-bromonaphthalene-1,6-dicarbaldehyde.
What is the SMILES notation for 5-bromonaphthalene-1,6-dicarbaldehyde?
The canonical SMILES for 5-bromonaphthalene-1,6-dicarbaldehyde is O=Cc1ccc2c(C=O)cccc2c1Br.
What is the InChIKey of 5-bromonaphthalene-1,6-dicarbaldehyde?
The InChIKey is GRTWYYHRIROQRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrO2/c13-12-9(7-15)4-5-10-8(6-14)2-1-3-11(10)12/h1-7H.
What are the key properties of 5-bromonaphthalene-1,6-dicarbaldehyde?
5-bromonaphthalene-1,6-dicarbaldehyde has a molecular weight of 263.09 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromonaphthalene-1,6-dicarbaldehyde is sourced from PubChem (CID 22151791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).