C8H18N2 — CID 22151997
(E)-1-N,1-N,1-N',1-N'-tetramethylbut-2-ene-1,1-diamine (PubChem CID 22151997) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is (E)-1-N,1-N,1-N',1-N'-tetramethylbut-2-ene-1,1-diamine.
| Compound Name | (E)-1-N,1-N,1-N',1-N'-tetramethylbut-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 22151997 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (E)-1-N,1-N,1-N',1-N'-tetramethylbut-2-ene-1,1-diamine |
| SMILES | C/C=C/C(N(C)C)N(C)C |
| InChI | InChI=1S/C8H18N2/c1-6-7-8(9(2)3)10(4)5/h6-8H,1-5H3/b7-6+ |
| InChIKey | CDUGNFNOFBDKOW-VOTSOKGWSA-N |
| XLogP | 1.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|