About 2-methylpropanal;propanal
2-methylpropanal;propanal (PubChem CID 22152471) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-methylpropanal;propanal.
Molecular Properties
| Compound Name | 2-methylpropanal;propanal |
| PubChem CID | 22152471 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-methylpropanal;propanal |
| SMILES | CC(C)C=O.CCC=O |
| InChI | InChI=1S/C4H8O.C3H6O/c1-4(2)3-5;1-2-3-4/h3-4H,1-2H3;3H,2H2,1H3 |
| InChIKey | VQYGBPYKYOAZFE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanal;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanal;propanal?
The IUPAC name of 2-methylpropanal;propanal (CID 22152471) is 2-methylpropanal;propanal.
What is the SMILES notation for 2-methylpropanal;propanal?
The canonical SMILES for 2-methylpropanal;propanal is CC(C)C=O.CCC=O.
What is the InChIKey of 2-methylpropanal;propanal?
The InChIKey is VQYGBPYKYOAZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3H6O/c1-4(2)3-5;1-2-3-4/h3-4H,1-2H3;3H,2H2,1H3.
What are the key properties of 2-methylpropanal;propanal?
2-methylpropanal;propanal has a molecular weight of 130.19 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanal;propanal is sourced from PubChem (CID 22152471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).