About 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate
1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate (PubChem CID 22152539) has the molecular formula C26H20N2O3
and a molecular weight of 408.46 g/mol. Its IUPAC name is 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate.
Molecular Properties
| Compound Name | 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate |
| PubChem CID | 22152539 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate |
| SMILES | O.O=C=Nc1cccc(-c2ccccc2)c1N=C=O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H8N2O2.C12H10.H2O/c17-9-15-13-8-4-7-12(14(13)16-10-18)11-5-2-1-3-6-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-8H;1-10H;1H2 |
| InChIKey | ARUGVQDAMPOGMD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate?
The IUPAC name of 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate (CID 22152539) is 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate.
What is the SMILES notation for 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate?
The canonical SMILES for 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate is O.O=C=Nc1cccc(-c2ccccc2)c1N=C=O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate?
The InChIKey is ARUGVQDAMPOGMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O2.C12H10.H2O/c17-9-15-13-8-4-7-12(14(13)16-10-18)11-5-2-1-3-6-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-8H;1-10H;1H2.
What are the key properties of 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate?
1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate has a molecular weight of 408.46 g/mol, XLogP of 5.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;1,2-diisocyanato-3-phenylbenzene;hydrate is sourced from PubChem (CID 22152539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).