C25H27ClN4O2S — CID 2215280
2-chloro-N-[(1S)-3-methyl-1-(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)butyl]benzamide (PubChem CID 2215280) has the molecular formula C25H27ClN4O2S and a molecular weight of 483.04 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-3-methyl-1-(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)butyl]benzamide.
| Compound Name | 2-chloro-N-[(1S)-3-methyl-1-(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)butyl]benzamide |
|---|---|
| PubChem CID | 2215280 |
| Molecular Formula | C25H27ClN4O2S |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-chloro-N-[(1S)-3-methyl-1-(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)butyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)c2ccccc2)nnc1[C@H](CC(C)C)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H27ClN4O2S/c1-4-14-30-23(28-29-25(30)33-16-22(31)18-10-6-5-7-11-18)21(15-17(2)3)27-24(32)19-12-8-9-13-20(19)26/h4-13,17,21H,1,14-16H2,2-3H3,(H,27,32)/t21-/m0/s1 |
| InChIKey | YEZCFZZTQRVOAL-NRFANRHFSA-N |
| XLogP | 5.61 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|