C21H22FIN2O2 — CID 22152869
N-(2,6-diethyl-4-fluorophenyl)-4-iodo-2,6-dimethyl-1-oxido-5-prop-2-ynylpyridin-1-ium-3-carboxamide (PubChem CID 22152869) has the molecular formula C21H22FIN2O2 and a molecular weight of 480.32 g/mol. Its IUPAC name is N-(2,6-diethyl-4-fluorophenyl)-4-iodo-2,6-dimethyl-1-oxido-5-prop-2-ynylpyridin-1-ium-3-carboxamide.
| Compound Name | N-(2,6-diethyl-4-fluorophenyl)-4-iodo-2,6-dimethyl-1-oxido-5-prop-2-ynylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 22152869 |
| Molecular Formula | C21H22FIN2O2 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | N-(2,6-diethyl-4-fluorophenyl)-4-iodo-2,6-dimethyl-1-oxido-5-prop-2-ynylpyridin-1-ium-3-carboxamide |
| SMILES | C#CCc1c(I)c(C(=O)Nc2c(CC)cc(F)cc2CC)c(C)[n+]([O-])c1C |
| InChI | InChI=1S/C21H22FIN2O2/c1-6-9-17-12(4)25(27)13(5)18(19(17)23)21(26)24-20-14(7-2)10-16(22)11-15(20)8-3/h1,10-11H,7-9H2,2-5H3,(H,24,26) |
| InChIKey | JZJXYBOHTJLGCC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|