C22H26BrFN2O — CID 22152888
4-bromo-5-[(E)-but-2-enyl]-N-(2,6-diethyl-4-fluorophenyl)-2,6-dimethylpyridine-3-carboxamide (PubChem CID 22152888) has the molecular formula C22H26BrFN2O and a molecular weight of 433.37 g/mol. Its IUPAC name is 4-bromo-5-[(E)-but-2-enyl]-N-(2,6-diethyl-4-fluorophenyl)-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | 4-bromo-5-[(E)-but-2-enyl]-N-(2,6-diethyl-4-fluorophenyl)-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 22152888 |
| Molecular Formula | C22H26BrFN2O |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-bromo-5-[(E)-but-2-enyl]-N-(2,6-diethyl-4-fluorophenyl)-2,6-dimethylpyridine-3-carboxamide |
| SMILES | C/C=C/Cc1c(C)nc(C)c(C(=O)Nc2c(CC)cc(F)cc2CC)c1Br |
| InChI | InChI=1S/C22H26BrFN2O/c1-6-9-10-18-13(4)25-14(5)19(20(18)23)22(27)26-21-15(7-2)11-17(24)12-16(21)8-3/h6,9,11-12H,7-8,10H2,1-5H3,(H,26,27)/b9-6+ |
| InChIKey | FBTSEQLRZIMOID-RMKNXTFCSA-N |
| XLogP | 6.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|