C22H29N3O2 — CID 2215331
5-butyl-1',5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione (PubChem CID 2215331) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 5-butyl-1',5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione.
| Compound Name | 5-butyl-1',5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 2215331 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 5-butyl-1',5',7-trimethylspiro[1,3-diazatricyclo[3.3.1.13,7]decane-2,3'-indole]-2',6-dione |
| SMILES | CCCCC12CN3CC(C)(CN(C1)C31C(=O)N(C)c3ccc(C)cc31)C2=O |
| InChI | InChI=1S/C22H29N3O2/c1-5-6-9-21-13-24-11-20(3,18(21)26)12-25(14-21)22(24)16-10-15(2)7-8-17(16)23(4)19(22)27/h7-8,10H,5-6,9,11-14H2,1-4H3 |
| InChIKey | SYJGSHWCKLKMHW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |