C19H20Br4N2O3 — CID 22153615
2-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-4,5,6,7-tetrabromoisoindole-1,3-dione (PubChem CID 22153615) has the molecular formula C19H20Br4N2O3 and a molecular weight of 644.00 g/mol. Its IUPAC name is 2-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-4,5,6,7-tetrabromoisoindole-1,3-dione.
| Compound Name | 2-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-4,5,6,7-tetrabromoisoindole-1,3-dione |
|---|---|
| PubChem CID | 22153615 |
| Molecular Formula | C19H20Br4N2O3 |
| Molecular Weight | 644.00 g/mol |
| Exact Mass | 639.82 |
| IUPAC Name | 2-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-4,5,6,7-tetrabromoisoindole-1,3-dione |
| SMILES | CC(=O)N1C(C)(C)CC(N2C(=O)c3c(Br)c(Br)c(Br)c(Br)c3C2=O)CC1(C)C |
| InChI | InChI=1S/C19H20Br4N2O3/c1-8(26)25-18(2,3)6-9(7-19(25,4)5)24-16(27)10-11(17(24)28)13(21)15(23)14(22)12(10)20/h9H,6-7H2,1-5H3 |
| InChIKey | BKCGAWKSDDDWTG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.00 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|