C21H26Cl6N2O2 — CID 22153622
1,7,8,9,10,10-hexachloro-4-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 22153622) has the molecular formula C21H26Cl6N2O2 and a molecular weight of 551.17 g/mol. Its IUPAC name is 1,7,8,9,10,10-hexachloro-4-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1,7,8,9,10,10-hexachloro-4-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 22153622 |
| Molecular Formula | C21H26Cl6N2O2 |
| Molecular Weight | 551.17 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | 1,7,8,9,10,10-hexachloro-4-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCC1(C)CC(N2C(=O)C3C(C2=O)C2(Cl)C(Cl)=C(Cl)C3(Cl)C2(Cl)Cl)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C21H26Cl6N2O2/c1-6-17(4)8-10(9(3)18(5,7-2)28-17)29-15(30)11-12(16(29)31)20(25)14(23)13(22)19(11,24)21(20,26)27/h9-12,28H,6-8H2,1-5H3 |
| InChIKey | ZRZCUPHGVCNPTP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.17 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|