3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid

C9H12O5S — CID 22155018

IUPAC3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid
SMILESCOC(=O)CCC1(C(=O)O)CSCC1=O
InChIInChI=1S/C9H12O5S/c1-14-7(11)2-3-9(8(12)13)5-15-4-6(9)10/h2-5H2,1H3,(H,12,13)
InChIKeyUHXIKTRZIXACKL-UHFFFAOYSA-N
MW232.26 g/mol
LogP0.33
Rot. Bonds4

About 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid

3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid (PubChem CID 22155018) has the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid.

Molecular Properties

Compound Name3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid
PubChem CID22155018
Molecular FormulaC9H12O5S
Molecular Weight232.26 g/mol
Exact Mass232.04
IUPAC Name3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid
SMILESCOC(=O)CCC1(C(=O)O)CSCC1=O
InChIInChI=1S/C9H12O5S/c1-14-7(11)2-3-9(8(12)13)5-15-4-6(9)10/h2-5H2,1H3,(H,12,13)
InChIKeyUHXIKTRZIXACKL-UHFFFAOYSA-N
XLogP0.33
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.26
LogP ≤ 50.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid?
The IUPAC name of 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid (CID 22155018) is 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid.
What is the SMILES notation for 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid?
The canonical SMILES for 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid is COC(=O)CCC1(C(=O)O)CSCC1=O.
What is the InChIKey of 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid?
The InChIKey is UHXIKTRZIXACKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5S/c1-14-7(11)2-3-9(8(12)13)5-15-4-6(9)10/h2-5H2,1H3,(H,12,13).
What are the key properties of 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid?
3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid has a molecular weight of 232.26 g/mol, XLogP of 0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxy-3-oxopropyl)-4-oxothiolane-3-carboxylic acid is sourced from PubChem (CID 22155018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).