About 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate
4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate (PubChem CID 22155151) has the molecular formula C9H17FN4O2
and a molecular weight of 232.26 g/mol. Its IUPAC name is 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate.
Molecular Properties
| Compound Name | 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate |
| PubChem CID | 22155151 |
| Molecular Formula | C9H17FN4O2 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate |
| SMILES | CCN(CC)Cn1cc(F)c(N)nc1=O.O |
| InChI | InChI=1S/C9H15FN4O.H2O/c1-3-13(4-2)6-14-5-7(10)8(11)12-9(14)15;/h5H,3-4,6H2,1-2H3,(H2,11,12,15);1H2 |
| InChIKey | PQAGBCWKLSXHSP-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate?
The IUPAC name of 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate (CID 22155151) is 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate.
What is the SMILES notation for 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate?
The canonical SMILES for 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate is CCN(CC)Cn1cc(F)c(N)nc1=O.O.
What is the InChIKey of 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate?
The InChIKey is PQAGBCWKLSXHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FN4O.H2O/c1-3-13(4-2)6-14-5-7(10)8(11)12-9(14)15;/h5H,3-4,6H2,1-2H3,(H2,11,12,15);1H2.
What are the key properties of 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate?
4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate has a molecular weight of 232.26 g/mol, XLogP of -0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-(diethylaminomethyl)-5-fluoropyrimidin-2-one;hydrate is sourced from PubChem (CID 22155151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).