C27H26ClNO4 — CID 2215546
9-(2-chloro-4-hydroxy-5-methoxyphenyl)-10-(3-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 2215546) has the molecular formula C27H26ClNO4 and a molecular weight of 463.96 g/mol. Its IUPAC name is 9-(2-chloro-4-hydroxy-5-methoxyphenyl)-10-(3-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(2-chloro-4-hydroxy-5-methoxyphenyl)-10-(3-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 2215546 |
| Molecular Formula | C27H26ClNO4 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 9-(2-chloro-4-hydroxy-5-methoxyphenyl)-10-(3-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | COc1cc(C2C3=C(CCCC3=O)N(c3cccc(C)c3)C3=C2C(=O)CCC3)c(Cl)cc1O |
| InChI | InChI=1S/C27H26ClNO4/c1-15-6-3-7-16(12-15)29-19-8-4-10-21(30)26(19)25(27-20(29)9-5-11-22(27)31)17-13-24(33-2)23(32)14-18(17)28/h3,6-7,12-14,25,32H,4-5,8-11H2,1-2H3 |
| InChIKey | JIYLEBQSUNDNTQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |