About (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride
(2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride (PubChem CID 22155879) has the molecular formula C18H27ClN2O2
and a molecular weight of 338.88 g/mol. Its IUPAC name is (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride |
| PubChem CID | 22155879 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride |
| SMILES | Cc1ncc(OC(=O)C2(C3CCCCC3)CCCCC2)cn1.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-14-19-12-16(13-20-14)22-17(21)18(10-6-3-7-11-18)15-8-4-2-5-9-15;/h12-13,15H,2-11H2,1H3;1H |
| InChIKey | URJTWRRYVWTOOE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride?
The IUPAC name of (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride (CID 22155879) is (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride.
What is the SMILES notation for (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride?
The canonical SMILES for (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride is Cc1ncc(OC(=O)C2(C3CCCCC3)CCCCC2)cn1.Cl.
What is the InChIKey of (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride?
The InChIKey is URJTWRRYVWTOOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O2.ClH/c1-14-19-12-16(13-20-14)22-17(21)18(10-6-3-7-11-18)15-8-4-2-5-9-15;/h12-13,15H,2-11H2,1H3;1H.
What are the key properties of (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride?
(2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride has a molecular weight of 338.88 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyrimidin-5-yl) 1-cyclohexylcyclohexane-1-carboxylate;hydrochloride is sourced from PubChem (CID 22155879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).