About 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride
2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride (PubChem CID 22155981) has the molecular formula C10H7ClF3NS2
and a molecular weight of 297.75 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride |
| PubChem CID | 22155981 |
| Molecular Formula | C10H7ClF3NS2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccccc1Sc1nccs1 |
| InChI | InChI=1S/C10H6F3NS2.ClH/c11-10(12,13)7-3-1-2-4-8(7)16-9-14-5-6-15-9;/h1-6H;1H |
| InChIKey | YYYWFLDWDBEJLB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride?
The IUPAC name of 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride (CID 22155981) is 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride.
What is the SMILES notation for 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride?
The canonical SMILES for 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride is Cl.FC(F)(F)c1ccccc1Sc1nccs1.
What is the InChIKey of 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride?
The InChIKey is YYYWFLDWDBEJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3NS2.ClH/c11-10(12,13)7-3-1-2-4-8(7)16-9-14-5-6-15-9;/h1-6H;1H.
What are the key properties of 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride?
2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride has a molecular weight of 297.75 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazole;hydrochloride is sourced from PubChem (CID 22155981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).