C8H13N5 — CID 22156012
6-cyclopentyl-1,3,5-triazine-2,4-diamine (PubChem CID 22156012) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 6-cyclopentyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cyclopentyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22156012 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 6-cyclopentyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C2CCCC2)n1 |
| InChI | InChI=1S/C8H13N5/c9-7-11-6(12-8(10)13-7)5-3-1-2-4-5/h5H,1-4H2,(H4,9,10,11,12,13) |
| InChIKey | JDVPCYNJSHTFEZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |