C24H19N3 — CID 22156545
1-N-phenyl-4-N-(5-phenyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-3-yl)benzene-1,4-diamine (PubChem CID 22156545) has the molecular formula C24H19N3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-N-phenyl-4-N-(5-phenyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-3-yl)benzene-1,4-diamine.
| Compound Name | 1-N-phenyl-4-N-(5-phenyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 22156545 |
| Molecular Formula | C24H19N3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-N-phenyl-4-N-(5-phenyl-7-azabicyclo[4.1.0]hepta-1,3,5-trien-3-yl)benzene-1,4-diamine |
| SMILES | c1ccc(Nc2ccc(Nc3cc4c(c(-c5ccccc5)c3)N4)cc2)cc1 |
| InChI | InChI=1S/C24H19N3/c1-3-7-17(8-4-1)22-15-21(16-23-24(22)27-23)26-20-13-11-19(12-14-20)25-18-9-5-2-6-10-18/h1-16,25-27H |
| InChIKey | OMBSPGCXFTUKQU-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|