C9H13N — CID 22156597
2,3,4,9a-tetrahydro-1H-quinolizine (PubChem CID 22156597) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2,3,4,9a-tetrahydro-1H-quinolizine.
| Compound Name | 2,3,4,9a-tetrahydro-1H-quinolizine |
|---|---|
| PubChem CID | 22156597 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2,3,4,9a-tetrahydro-1H-quinolizine |
| SMILES | C1=CC2CCCCN2C=C1 |
| InChI | InChI=1S/C9H13N/c1-3-7-10-8-4-2-6-9(10)5-1/h1,3,5,7,9H,2,4,6,8H2 |
| InChIKey | TXYMGULNHLNAFZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |