About fluoranthen-8-amine
fluoranthen-8-amine (PubChem CID 22157) has the molecular formula C16H11N
and a molecular weight of 217.27 g/mol. Its IUPAC name is fluoranthen-8-amine.
Molecular Properties
| Compound Name | fluoranthen-8-amine |
| PubChem CID | 22157 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | fluoranthen-8-amine |
| SMILES | Nc1ccc2c(c1)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C16H11N/c17-11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11/h1-9H,17H2 |
| InChIKey | SMSRNTQALUJAHQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze fluoranthen-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoranthen-8-amine?
The IUPAC name of fluoranthen-8-amine (CID 22157) is fluoranthen-8-amine.
What is the SMILES notation for fluoranthen-8-amine?
The canonical SMILES for fluoranthen-8-amine is Nc1ccc2c(c1)-c1cccc3cccc-2c13.
What is the InChIKey of fluoranthen-8-amine?
The InChIKey is SMSRNTQALUJAHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N/c17-11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11/h1-9H,17H2.
What are the key properties of fluoranthen-8-amine?
fluoranthen-8-amine has a molecular weight of 217.27 g/mol, XLogP of 4.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoranthen-8-amine is sourced from PubChem (CID 22157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).