C28H18N6O3 — CID 2215713
2-[4-(3,5-diphenyl-1,2,4-triazol-4-yl)-3-nitrophenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 2215713) has the molecular formula C28H18N6O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is 2-[4-(3,5-diphenyl-1,2,4-triazol-4-yl)-3-nitrophenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-(3,5-diphenyl-1,2,4-triazol-4-yl)-3-nitrophenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2215713 |
| Molecular Formula | C28H18N6O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[4-(3,5-diphenyl-1,2,4-triazol-4-yl)-3-nitrophenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(-c2nnc(-c3ccccc3)o2)ccc1-n1c(-c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C28H18N6O3/c35-34(36)24-18-22(28-32-31-27(37-28)21-14-8-3-9-15-21)16-17-23(24)33-25(19-10-4-1-5-11-19)29-30-26(33)20-12-6-2-7-13-20/h1-18H |
| InChIKey | FHAFTAUZRQXLBZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|