C8H9F5 — CID 22157762
(2Z)-2-(difluoromethyl)-1,1,1-trifluoro-5-methylhexa-2,4-diene (PubChem CID 22157762) has the molecular formula C8H9F5 and a molecular weight of 200.15 g/mol. Its IUPAC name is (2Z)-2-(difluoromethyl)-1,1,1-trifluoro-5-methylhexa-2,4-diene.
| Compound Name | (2Z)-2-(difluoromethyl)-1,1,1-trifluoro-5-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 22157762 |
| Molecular Formula | C8H9F5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (2Z)-2-(difluoromethyl)-1,1,1-trifluoro-5-methylhexa-2,4-diene |
| SMILES | CC(C)=C/C=C(/C(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5/c1-5(2)3-4-6(7(9)10)8(11,12)13/h3-4,7H,1-2H3/b6-4- |
| InChIKey | GFMNEHCEZSAWPO-XQRVVYSFSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|