About 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione
2-(2-fluorophenyl)-1,3-oxazole-4,5-dione (PubChem CID 22157830) has the molecular formula C9H4FNO3
and a molecular weight of 193.13 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione |
| PubChem CID | 22157830 |
| Molecular Formula | C9H4FNO3 |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione |
| SMILES | O=C1N=C(c2ccccc2F)OC1=O |
| InChI | InChI=1S/C9H4FNO3/c10-6-4-2-1-3-5(6)8-11-7(12)9(13)14-8/h1-4H |
| InChIKey | VJXQNCVWUMUXSC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione?
The IUPAC name of 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione (CID 22157830) is 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione.
What is the SMILES notation for 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione?
The canonical SMILES for 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione is O=C1N=C(c2ccccc2F)OC1=O.
What is the InChIKey of 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione?
The InChIKey is VJXQNCVWUMUXSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4FNO3/c10-6-4-2-1-3-5(6)8-11-7(12)9(13)14-8/h1-4H.
What are the key properties of 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione?
2-(2-fluorophenyl)-1,3-oxazole-4,5-dione has a molecular weight of 193.13 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-1,3-oxazole-4,5-dione is sourced from PubChem (CID 22157830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).