About 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline
6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline (PubChem CID 22158251) has the molecular formula C23H17Cl2NO
and a molecular weight of 394.30 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline |
| PubChem CID | 22158251 |
| Molecular Formula | C23H17Cl2NO |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline |
| SMILES | Clc1ccc(/C=C/C2=NCCc3cc(Oc4ccc(Cl)cc4)ccc32)cc1 |
| InChI | InChI=1S/C23H17Cl2NO/c24-18-4-1-16(2-5-18)3-12-23-22-11-10-21(15-17(22)13-14-26-23)27-20-8-6-19(25)7-9-20/h1-12,15H,13-14H2/b12-3+ |
| InChIKey | YRAPTRVHORPUFW-KGVSQERTSA-N |
| XLogP | 6.84 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
The IUPAC name of 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline (CID 22158251) is 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline.
What is the SMILES notation for 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
The canonical SMILES for 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline is Clc1ccc(/C=C/C2=NCCc3cc(Oc4ccc(Cl)cc4)ccc32)cc1.
What is the InChIKey of 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
The InChIKey is YRAPTRVHORPUFW-KGVSQERTSA-N. The full InChI is InChI=1S/C23H17Cl2NO/c24-18-4-1-16(2-5-18)3-12-23-22-11-10-21(15-17(22)13-14-26-23)27-20-8-6-19(25)7-9-20/h1-12,15H,13-14H2/b12-3+.
What are the key properties of 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline?
6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline has a molecular weight of 394.30 g/mol, XLogP of 6.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenoxy)-1-[(E)-2-(4-chlorophenyl)ethenyl]-3,4-dihydroisoquinoline is sourced from PubChem (CID 22158251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).