About 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride
6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 22158294) has the molecular formula C21H24ClNO
and a molecular weight of 341.88 g/mol. Its IUPAC name is 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 22158294 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | CCCCOc1ccc2c(c1)CCN=C2/C=C/c1ccccc1.Cl |
| InChI | InChI=1S/C21H23NO.ClH/c1-2-3-15-23-19-10-11-20-18(16-19)13-14-22-21(20)12-9-17-7-5-4-6-8-17;/h4-12,16H,2-3,13-15H2,1H3;1H/b12-9+; |
| InChIKey | ZFZBCUBYCUGPNX-NBYYMMLRSA-N |
| XLogP | 5.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride (CID 22158294) is 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride is CCCCOc1ccc2c(c1)CCN=C2/C=C/c1ccccc1.Cl.
What is the InChIKey of 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is ZFZBCUBYCUGPNX-NBYYMMLRSA-N. The full InChI is InChI=1S/C21H23NO.ClH/c1-2-3-15-23-19-10-11-20-18(16-19)13-14-22-21(20)12-9-17-7-5-4-6-8-17;/h4-12,16H,2-3,13-15H2,1H3;1H/b12-9+;.
What are the key properties of 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride?
6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 341.88 g/mol, XLogP of 5.35, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxy-1-[(E)-2-phenylethenyl]-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 22158294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).