C22H36ClN3O2 — CID 22158313
6-(dimethylamino)-N-[2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]hexanamide;hydrate;hydrochloride (PubChem CID 22158313) has the molecular formula C22H36ClN3O2 and a molecular weight of 410.00 g/mol. Its IUPAC name is 6-(dimethylamino)-N-[2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]hexanamide;hydrate;hydrochloride.
| Compound Name | 6-(dimethylamino)-N-[2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]hexanamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 22158313 |
| Molecular Formula | C22H36ClN3O2 |
| Molecular Weight | 410.00 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 6-(dimethylamino)-N-[2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)ethyl]hexanamide;hydrate;hydrochloride |
| SMILES | CN(C)CCCCCC(=O)NCCc1c2n(c3ccccc13)CCCC2.Cl.O |
| InChI | InChI=1S/C22H33N3O.ClH.H2O/c1-24(2)16-8-3-4-13-22(26)23-15-14-19-18-10-5-6-11-20(18)25-17-9-7-12-21(19)25;;/h5-6,10-11H,3-4,7-9,12-17H2,1-2H3,(H,23,26);1H;1H2 |
| InChIKey | OSDNNHKMUPPCNE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|