C10H15F3N2O4S2 — CID 22158418
trifluoromethanesulfonate;1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one (PubChem CID 22158418) has the molecular formula C10H15F3N2O4S2 and a molecular weight of 348.37 g/mol. Its IUPAC name is trifluoromethanesulfonate;1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one.
| Compound Name | trifluoromethanesulfonate;1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one |
|---|---|
| PubChem CID | 22158418 |
| Molecular Formula | C10H15F3N2O4S2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | trifluoromethanesulfonate;1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one |
| SMILES | CC(=O)CSc1n(C)c(C)c[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H15N2OS.CHF3O3S/c1-7-5-10(3)9(11(7)4)13-6-8(2)12;2-1(3,4)8(5,6)7/h5H,6H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ULRGMRXCWBPVSX-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|