About 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine
2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine (PubChem CID 22158540) has the molecular formula C6H5ClF2N2O2S
and a molecular weight of 242.63 g/mol. Its IUPAC name is 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine.
Molecular Properties
| Compound Name | 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine |
| PubChem CID | 22158540 |
| Molecular Formula | C6H5ClF2N2O2S |
| Molecular Weight | 242.63 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine |
| SMILES | CCS(=O)(=O)c1c(F)nc(Cl)nc1F |
| InChI | InChI=1S/C6H5ClF2N2O2S/c1-2-14(12,13)3-4(8)10-6(7)11-5(3)9/h2H2,1H3 |
| InChIKey | LPURDPUQIUZPJZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine?
The IUPAC name of 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine (CID 22158540) is 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine.
What is the SMILES notation for 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine?
The canonical SMILES for 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine is CCS(=O)(=O)c1c(F)nc(Cl)nc1F.
What is the InChIKey of 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine?
The InChIKey is LPURDPUQIUZPJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClF2N2O2S/c1-2-14(12,13)3-4(8)10-6(7)11-5(3)9/h2H2,1H3.
What are the key properties of 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine?
2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine has a molecular weight of 242.63 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-ethylsulfonyl-4,6-difluoropyrimidine is sourced from PubChem (CID 22158540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).