About 5-benzylsulfonyl-2,4,6-trifluoropyrimidine
5-benzylsulfonyl-2,4,6-trifluoropyrimidine (PubChem CID 22158541) has the molecular formula C11H7F3N2O2S
and a molecular weight of 288.25 g/mol. Its IUPAC name is 5-benzylsulfonyl-2,4,6-trifluoropyrimidine.
Molecular Properties
| Compound Name | 5-benzylsulfonyl-2,4,6-trifluoropyrimidine |
| PubChem CID | 22158541 |
| Molecular Formula | C11H7F3N2O2S |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 5-benzylsulfonyl-2,4,6-trifluoropyrimidine |
| SMILES | O=S(=O)(Cc1ccccc1)c1c(F)nc(F)nc1F |
| InChI | InChI=1S/C11H7F3N2O2S/c12-9-8(10(13)16-11(14)15-9)19(17,18)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | KURXSYOFIUIGLH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzylsulfonyl-2,4,6-trifluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylsulfonyl-2,4,6-trifluoropyrimidine?
The IUPAC name of 5-benzylsulfonyl-2,4,6-trifluoropyrimidine (CID 22158541) is 5-benzylsulfonyl-2,4,6-trifluoropyrimidine.
What is the SMILES notation for 5-benzylsulfonyl-2,4,6-trifluoropyrimidine?
The canonical SMILES for 5-benzylsulfonyl-2,4,6-trifluoropyrimidine is O=S(=O)(Cc1ccccc1)c1c(F)nc(F)nc1F.
What is the InChIKey of 5-benzylsulfonyl-2,4,6-trifluoropyrimidine?
The InChIKey is KURXSYOFIUIGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F3N2O2S/c12-9-8(10(13)16-11(14)15-9)19(17,18)6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 5-benzylsulfonyl-2,4,6-trifluoropyrimidine?
5-benzylsulfonyl-2,4,6-trifluoropyrimidine has a molecular weight of 288.25 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylsulfonyl-2,4,6-trifluoropyrimidine is sourced from PubChem (CID 22158541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).