C10H9F3N4S — CID 22159300
2-(trifluoromethyl)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazoline-9-thione (PubChem CID 22159300) has the molecular formula C10H9F3N4S and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazoline-9-thione.
| Compound Name | 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazoline-9-thione |
|---|---|
| PubChem CID | 22159300 |
| Molecular Formula | C10H9F3N4S |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazoline-9-thione |
| SMILES | FC(F)(F)c1nc2nc3c(c(=S)n2[nH]1)CCCC3 |
| InChI | InChI=1S/C10H9F3N4S/c11-10(12,13)8-15-9-14-6-4-2-1-3-5(6)7(18)17(9)16-8/h1-4H2,(H,14,15,16) |
| InChIKey | VNARTKIYJLRRSC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|