C15H17Cl3N2O4 — CID 2215942
5,5-dimethyl-3-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]imidazolidine-2,4-dione (PubChem CID 2215942) has the molecular formula C15H17Cl3N2O4 and a molecular weight of 395.67 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2215942 |
| Molecular Formula | C15H17Cl3N2O4 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 5,5-dimethyl-3-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCOCCOc2c(Cl)cc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C15H17Cl3N2O4/c1-15(2)13(21)20(14(22)19-15)3-4-23-5-6-24-12-10(17)7-9(16)8-11(12)18/h7-8H,3-6H2,1-2H3,(H,19,22) |
| InChIKey | SZOHPZVWJNJNOK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|