C19H9F6NO3 — CID 22159845
1-methyl-4-oxo-2,6-bis(2,3,4-trifluorophenyl)pyridine-3-carboxylic acid (PubChem CID 22159845) has the molecular formula C19H9F6NO3 and a molecular weight of 413.27 g/mol. Its IUPAC name is 1-methyl-4-oxo-2,6-bis(2,3,4-trifluorophenyl)pyridine-3-carboxylic acid.
| Compound Name | 1-methyl-4-oxo-2,6-bis(2,3,4-trifluorophenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22159845 |
| Molecular Formula | C19H9F6NO3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-methyl-4-oxo-2,6-bis(2,3,4-trifluorophenyl)pyridine-3-carboxylic acid |
| SMILES | Cn1c(-c2ccc(F)c(F)c2F)cc(=O)c(C(=O)O)c1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H9F6NO3/c1-26-11(7-2-4-9(20)16(24)14(7)22)6-12(27)13(19(28)29)18(26)8-3-5-10(21)17(25)15(8)23/h2-6H,1H3,(H,28,29) |
| InChIKey | SAUKHFLVSBLKPX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|