About [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate
[1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate (PubChem CID 22160501) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate.
Molecular Properties
| Compound Name | [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate |
| PubChem CID | 22160501 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate |
| SMILES | CCC(OC(C)=O)C(=O)c1ccc(C2=NNC(=O)CC2C)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-4-14(23-11(3)20)17(22)13-7-5-12(6-8-13)16-10(2)9-15(21)18-19-16/h5-8,10,14H,4,9H2,1-3H3,(H,18,21) |
| InChIKey | HUFZKSGYXVXQDV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate?
The IUPAC name of [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate (CID 22160501) is [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate.
What is the SMILES notation for [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate?
The canonical SMILES for [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate is CCC(OC(C)=O)C(=O)c1ccc(C2=NNC(=O)CC2C)cc1.
What is the InChIKey of [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate?
The InChIKey is HUFZKSGYXVXQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-4-14(23-11(3)20)17(22)13-7-5-12(6-8-13)16-10(2)9-15(21)18-19-16/h5-8,10,14H,4,9H2,1-3H3,(H,18,21).
What are the key properties of [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate?
[1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate has a molecular weight of 316.36 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]-1-oxobutan-2-yl] acetate is sourced from PubChem (CID 22160501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).