About N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine
N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 22160579) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine |
| PubChem CID | 22160579 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CONC1COC(C)(C)OC1 |
| InChI | InChI=1S/C7H15NO3/c1-7(2)10-4-6(5-11-7)8-9-3/h6,8H,4-5H2,1-3H3 |
| InChIKey | XRPJJXXXXLIKRL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine?
The IUPAC name of N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine (CID 22160579) is N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine.
What is the SMILES notation for N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine?
The canonical SMILES for N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine is CONC1COC(C)(C)OC1.
What is the InChIKey of N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine?
The InChIKey is XRPJJXXXXLIKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO3/c1-7(2)10-4-6(5-11-7)8-9-3/h6,8H,4-5H2,1-3H3.
What are the key properties of N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine?
N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine has a molecular weight of 161.20 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-2,2-dimethyl-1,3-dioxan-5-amine is sourced from PubChem (CID 22160579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).