About 4-methoxy-2H-furan-5-one;propan-2-one
4-methoxy-2H-furan-5-one;propan-2-one (PubChem CID 22160665) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 4-methoxy-2H-furan-5-one;propan-2-one.
Molecular Properties
| Compound Name | 4-methoxy-2H-furan-5-one;propan-2-one |
| PubChem CID | 22160665 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-methoxy-2H-furan-5-one;propan-2-one |
| SMILES | CC(C)=O.COC1=CCOC1=O |
| InChI | InChI=1S/C5H6O3.C3H6O/c1-7-4-2-3-8-5(4)6;1-3(2)4/h2H,3H2,1H3;1-2H3 |
| InChIKey | CRWAKTUAFJLQOM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-2H-furan-5-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2H-furan-5-one;propan-2-one?
The IUPAC name of 4-methoxy-2H-furan-5-one;propan-2-one (CID 22160665) is 4-methoxy-2H-furan-5-one;propan-2-one.
What is the SMILES notation for 4-methoxy-2H-furan-5-one;propan-2-one?
The canonical SMILES for 4-methoxy-2H-furan-5-one;propan-2-one is CC(C)=O.COC1=CCOC1=O.
What is the InChIKey of 4-methoxy-2H-furan-5-one;propan-2-one?
The InChIKey is CRWAKTUAFJLQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.C3H6O/c1-7-4-2-3-8-5(4)6;1-3(2)4/h2H,3H2,1H3;1-2H3.
What are the key properties of 4-methoxy-2H-furan-5-one;propan-2-one?
4-methoxy-2H-furan-5-one;propan-2-one has a molecular weight of 172.18 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2H-furan-5-one;propan-2-one is sourced from PubChem (CID 22160665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).