About 3-(chloromethyl)-2,4-diethyloxetane
3-(chloromethyl)-2,4-diethyloxetane (PubChem CID 22160815) has the molecular formula C8H15ClO
and a molecular weight of 162.66 g/mol. Its IUPAC name is 3-(chloromethyl)-2,4-diethyloxetane.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2,4-diethyloxetane |
| PubChem CID | 22160815 |
| Molecular Formula | C8H15ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-(chloromethyl)-2,4-diethyloxetane |
| SMILES | CCC1OC(CC)C1CCl |
| InChI | InChI=1S/C8H15ClO/c1-3-7-6(5-9)8(4-2)10-7/h6-8H,3-5H2,1-2H3 |
| InChIKey | FNUVOQBXTYOAFG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2,4-diethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2,4-diethyloxetane?
The IUPAC name of 3-(chloromethyl)-2,4-diethyloxetane (CID 22160815) is 3-(chloromethyl)-2,4-diethyloxetane.
What is the SMILES notation for 3-(chloromethyl)-2,4-diethyloxetane?
The canonical SMILES for 3-(chloromethyl)-2,4-diethyloxetane is CCC1OC(CC)C1CCl.
What is the InChIKey of 3-(chloromethyl)-2,4-diethyloxetane?
The InChIKey is FNUVOQBXTYOAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO/c1-3-7-6(5-9)8(4-2)10-7/h6-8H,3-5H2,1-2H3.
What are the key properties of 3-(chloromethyl)-2,4-diethyloxetane?
3-(chloromethyl)-2,4-diethyloxetane has a molecular weight of 162.66 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2,4-diethyloxetane is sourced from PubChem (CID 22160815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).