About methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate
methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate (PubChem CID 22160915) has the molecular formula C25H34N2OS
and a molecular weight of 410.63 g/mol. Its IUPAC name is methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate |
| PubChem CID | 22160915 |
| Molecular Formula | C25H34N2OS |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate |
| SMILES | CS/C(=N\C(C)C)Nc1c(C(C)C)cc(Oc2ccccc2)cc1C1CCCC1 |
| InChI | InChI=1S/C25H34N2OS/c1-17(2)22-15-21(28-20-13-7-6-8-14-20)16-23(19-11-9-10-12-19)24(22)27-25(29-5)26-18(3)4/h6-8,13-19H,9-12H2,1-5H3,(H,26,27) |
| InChIKey | FCTUBNJHHDGCNK-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate?
The IUPAC name of methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate (CID 22160915) is methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate.
What is the SMILES notation for methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate?
The canonical SMILES for methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate is CS/C(=N\C(C)C)Nc1c(C(C)C)cc(Oc2ccccc2)cc1C1CCCC1.
What is the InChIKey of methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate?
The InChIKey is FCTUBNJHHDGCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N2OS/c1-17(2)22-15-21(28-20-13-7-6-8-14-20)16-23(19-11-9-10-12-19)24(22)27-25(29-5)26-18(3)4/h6-8,13-19H,9-12H2,1-5H3,(H,26,27).
What are the key properties of methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate?
methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate has a molecular weight of 410.63 g/mol, XLogP of 7.80, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2-cyclopentyl-4-phenoxy-6-propan-2-ylphenyl)-N'-propan-2-ylcarbamimidothioate is sourced from PubChem (CID 22160915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).