About dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol
dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol (PubChem CID 22160999) has the molecular formula C6H17NO4P+
and a molecular weight of 198.18 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol |
| PubChem CID | 22160999 |
| Molecular Formula | C6H17NO4P+ |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol |
| SMILES | CC(C)N(C)CCO.O=[P+](O)O |
| InChI | InChI=1S/C6H15NO.HO3P/c1-6(2)7(3)4-5-8;1-4(2)3/h6,8H,4-5H2,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | AGQHFLVSAVSDFS-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol?
The IUPAC name of dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol (CID 22160999) is dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol.
What is the SMILES notation for dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol?
The canonical SMILES for dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol is CC(C)N(C)CCO.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol?
The InChIKey is AGQHFLVSAVSDFS-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15NO.HO3P/c1-6(2)7(3)4-5-8;1-4(2)3/h6,8H,4-5H2,1-3H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol?
dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol has a molecular weight of 198.18 g/mol, XLogP of -0.05, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;2-[methyl(propan-2-yl)amino]ethanol is sourced from PubChem (CID 22160999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).