About dihydroxy(oxo)phosphanium;N-methylpropan-2-amine
dihydroxy(oxo)phosphanium;N-methylpropan-2-amine (PubChem CID 22161000) has the molecular formula C4H13NO3P+
and a molecular weight of 154.13 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;N-methylpropan-2-amine.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;N-methylpropan-2-amine |
| PubChem CID | 22161000 |
| Molecular Formula | C4H13NO3P+ |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | dihydroxy(oxo)phosphanium;N-methylpropan-2-amine |
| SMILES | CNC(C)C.O=[P+](O)O |
| InChI | InChI=1S/C4H11N.HO3P/c1-4(2)5-3;1-4(2)3/h4-5H,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | WRBICHXLGKFBQC-UHFFFAOYSA-O |
| XLogP | 0.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;N-methylpropan-2-amine?
The IUPAC name of dihydroxy(oxo)phosphanium;N-methylpropan-2-amine (CID 22161000) is dihydroxy(oxo)phosphanium;N-methylpropan-2-amine.
What is the SMILES notation for dihydroxy(oxo)phosphanium;N-methylpropan-2-amine?
The canonical SMILES for dihydroxy(oxo)phosphanium;N-methylpropan-2-amine is CNC(C)C.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;N-methylpropan-2-amine?
The InChIKey is WRBICHXLGKFBQC-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H11N.HO3P/c1-4(2)5-3;1-4(2)3/h4-5H,1-3H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;N-methylpropan-2-amine?
dihydroxy(oxo)phosphanium;N-methylpropan-2-amine has a molecular weight of 154.13 g/mol, XLogP of 0.24, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;N-methylpropan-2-amine is sourced from PubChem (CID 22161000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).