About 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride
3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride (PubChem CID 22161032) has the molecular formula C13H17ClN2O
and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride |
| PubChem CID | 22161032 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride |
| SMILES | CN1CCCN=C1/C=C/C2=CC(=CC=C2)O.Cl |
| InChI | InChI=1S/C13H16N2O.ClH/c1-15-9-3-8-14-13(15)7-6-11-4-2-5-12(16)10-11;/h2,4-7,10,16H,3,8-9H2,1H3;1H/b7-6+; |
| InChIKey | GFGNOEAYBYDCJM-UHDJGPCESA-N |
| XLogP | — |
| TPSA | 35.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 286 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride?
The IUPAC name of 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride (CID 22161032) is 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride.
What is the SMILES notation for 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride?
The canonical SMILES for 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride is CN1CCCN=C1/C=C/C2=CC(=CC=C2)O.Cl.
What is the InChIKey of 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride?
The InChIKey is GFGNOEAYBYDCJM-UHDJGPCESA-N. The full InChI is InChI=1S/C13H16N2O.ClH/c1-15-9-3-8-14-13(15)7-6-11-4-2-5-12(16)10-11;/h2,4-7,10,16H,3,8-9H2,1H3;1H/b7-6+;.
What are the key properties of 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride?
3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride has a molecular weight of 252.74 g/mol, XLogP of not available, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol;hydrochloride is sourced from PubChem (CID 22161032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).