About 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate
4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate (PubChem CID 22161043) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate.
Analyze 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
The IUPAC name of 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate (CID 22161043) is 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate.
What is the SMILES notation for 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
The canonical SMILES for 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate is CC(=O)OC(C)CCC1=C(C)C(=O)CCC1(C)C.
What is the InChIKey of 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
The InChIKey is ITKHQGXAXXVHBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-10(18-12(3)16)6-7-13-11(2)14(17)8-9-15(13,4)5/h10H,6-9H2,1-5H3.
What are the key properties of 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate has a molecular weight of 252.35 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate is sourced from PubChem (CID 22161043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).