C18H30O5 — CID 22161299
3-[4-(1,2-dihydroxyethyl)hepta-1,6-dien-4-yloxy]-3-prop-2-enylhex-5-ene-1,2-diol (PubChem CID 22161299) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 3-[4-(1,2-dihydroxyethyl)hepta-1,6-dien-4-yloxy]-3-prop-2-enylhex-5-ene-1,2-diol.
| Compound Name | 3-[4-(1,2-dihydroxyethyl)hepta-1,6-dien-4-yloxy]-3-prop-2-enylhex-5-ene-1,2-diol |
|---|---|
| PubChem CID | 22161299 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 3-[4-(1,2-dihydroxyethyl)hepta-1,6-dien-4-yloxy]-3-prop-2-enylhex-5-ene-1,2-diol |
| SMILES | C=CCC(CC=C)(OC(CC=C)(CC=C)C(O)CO)C(O)CO |
| InChI | InChI=1S/C18H30O5/c1-5-9-17(10-6-2,15(21)13-19)23-18(11-7-3,12-8-4)16(22)14-20/h5-8,15-16,19-22H,1-4,9-14H2 |
| InChIKey | OXBNFRVQOQVXIN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|