C20H28N2O5S2 — CID 22161722
methanesulfonic acid;[2-(3-thiophen-2-ylpropyl)-3,4-dihydro-1H-isoquinolin-6-yl] N,N-dimethylcarbamate (PubChem CID 22161722) has the molecular formula C20H28N2O5S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is methanesulfonic acid;[2-(3-thiophen-2-ylpropyl)-3,4-dihydro-1H-isoquinolin-6-yl] N,N-dimethylcarbamate.
| Compound Name | methanesulfonic acid;[2-(3-thiophen-2-ylpropyl)-3,4-dihydro-1H-isoquinolin-6-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 22161722 |
| Molecular Formula | C20H28N2O5S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methanesulfonic acid;[2-(3-thiophen-2-ylpropyl)-3,4-dihydro-1H-isoquinolin-6-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc2c(c1)CCN(CCCc1cccs1)C2.CS(=O)(=O)O |
| InChI | InChI=1S/C19H24N2O2S.CH4O3S/c1-20(2)19(22)23-17-8-7-16-14-21(11-9-15(16)13-17)10-3-5-18-6-4-12-24-18;1-5(2,3)4/h4,6-8,12-13H,3,5,9-11,14H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | GVRMBCGSDUHMCZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|